* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-86070 |
| English Synonyms: | CHEMMAKER BCB-86070 |
| MDL Number.: | MFCD18768699 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cnc(cc2C#N)NC(C)c3ccccc3 |
| InChi: | InChI=1S/C20H24BN3O2/c1-14(15-9-7-6-8-10-15)24-18-11-16(12-22)17(13-23-18)21-25-19(2,3)20(4,5)26-21/h6-11,13-14H,1-5H3,(H,23,24) |
| InChiKey: | InChIKey=SXZIFYYIBWMVMJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.