* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-87189 |
| English Synonyms: | CHEMMAKER BCB-87189 |
| MDL Number.: | MFCD18769615 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(c(nc2)NC[C@@H]3CCCN3CC)F |
| InChi: | InChI=1S/C18H29BFN3O2/c1-6-23-9-7-8-14(23)12-22-16-15(20)10-13(11-21-16)19-24-17(2,3)18(4,5)25-19/h10-11,14H,6-9,12H2,1-5H3,(H,21,22)/t14-/m0/s1 |
| InChiKey: | InChIKey=WFASQCFXQNIGEV-AWEZNQCLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.