* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-88098 |
| English Synonyms: | CHEMMAKER BCB-88098 |
| MDL Number.: | MFCD18770367 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(nc2C)NCCCc3ccccc3 |
| InChi: | InChI=1S/C21H29BN2O2/c1-16-18(22-25-20(2,3)21(4,5)26-22)13-14-19(24-16)23-15-9-12-17-10-7-6-8-11-17/h6-8,10-11,13-14H,9,12,15H2,1-5H3,(H,23,24) |
| InChiKey: | InChIKey=DTPZQWZXBGAWBQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.