* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-89142 |
| English Synonyms: | CHEMMAKER BCB-89142 |
| MDL Number.: | MFCD18771320 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2c(ccnc2N3CCN(CC3)C(C)(C)C)C |
| InChi: | InChI=1S/C20H34BN3O2/c1-15-9-10-22-17(23-11-13-24(14-12-23)18(2,3)4)16(15)21-25-19(5,6)20(7,8)26-21/h9-10H,11-14H2,1-8H3 |
| InChiKey: | InChIKey=KTLROPYFXVMKMC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.