* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-89936 |
| English Synonyms: | CHEMMAKER BCB-89936 |
| MDL Number.: | MFCD18772015 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(c(nc2)N3CCC[C@@H]3CN4CCCC4)Cl |
| InChi: | InChI=1S/C20H31BClN3O2/c1-19(2)20(3,4)27-21(26-19)15-12-17(22)18(23-13-15)25-11-7-8-16(25)14-24-9-5-6-10-24/h12-13,16H,5-11,14H2,1-4H3/t16-/m1/s1 |
| InChiKey: | InChIKey=HQHIWUWQKBXZCV-MRXNPFEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.