* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-89945 |
| English Synonyms: | CHEMMAKER BCB-89945 |
| MDL Number.: | MFCD18772024 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cnc(cc2C)N3CCC[C@@H]3CN4CCCC4 |
| InChi: | InChI=1S/C21H34BN3O2/c1-16-13-19(25-12-8-9-17(25)15-24-10-6-7-11-24)23-14-18(16)22-26-20(2,3)21(4,5)27-22/h13-14,17H,6-12,15H2,1-5H3/t17-/m1/s1 |
| InChiKey: | InChIKey=KVFWAPNBVQHIKH-QGZVFWFLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.