* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-90182 |
English Synonyms: | CHEMMAKER BCB-90182 |
MDL Number.: | MFCD18772261 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(cc(n2)N3CCC(CC3)N(CC)CC)F |
InChi: | InChI=1S/C20H33BFN3O2/c1-7-24(8-2)16-9-11-25(12-10-16)18-14-15(22)13-17(23-18)21-26-19(3,4)20(5,6)27-21/h13-14,16H,7-12H2,1-6H3 |
InChiKey: | InChIKey=WHGORGYABNMPAN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.