* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-90356 |
| English Synonyms: | CHEMMAKER BCB-90356 |
| MDL Number.: | MFCD18772435 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(cnc2N3CCC3C(=O)OC(C)(C)C)C |
| InChi: | InChI=1S/C20H31BN2O4/c1-13-11-14(21-26-19(5,6)20(7,8)27-21)16(22-12-13)23-10-9-15(23)17(24)25-18(2,3)4/h11-12,15H,9-10H2,1-8H3 |
| InChiKey: | InChIKey=SQBKHBADQHLEBD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.