* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-90408 |
English Synonyms: | CHEMMAKER BCB-90408 |
MDL Number.: | MFCD18772487 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2c(ccc(n2)N3CCCC[C@@H]3C(=O)OCC)F |
InChi: | InChI=1S/C19H28BFN2O4/c1-6-25-17(24)14-9-7-8-12-23(14)15-11-10-13(21)16(22-15)20-26-18(2,3)19(4,5)27-20/h10-11,14H,6-9,12H2,1-5H3/t14-/m1/s1 |
InChiKey: | InChIKey=NHGTUBAJBRKBIR-CQSZACIVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.