* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-90411 |
English Synonyms: | CHEMMAKER BCB-90411 |
MDL Number.: | MFCD18772490 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(c(n2)N3CCCC[C@@H]3C(=O)OCC)C |
InChi: | InChI=1S/C20H31BN2O4/c1-7-25-18(24)15-10-8-9-13-23(15)17-14(2)11-12-16(22-17)21-26-19(3,4)20(5,6)27-21/h11-12,15H,7-10,13H2,1-6H3/t15-/m1/s1 |
InChiKey: | InChIKey=QZYFGAYHIWZCGS-OAHLLOKOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.