* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-90638 |
English Synonyms: | CHEMMAKER BCB-90638 |
MDL Number.: | MFCD18772716 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2c(ccc(n2)N3CCN(CC3)CCC(=O)O)C |
InChi: | InChI=1S/C19H30BN3O4/c1-14-6-7-15(23-12-10-22(11-13-23)9-8-16(24)25)21-17(14)20-26-18(2,3)19(4,5)27-20/h6-7H,8-13H2,1-5H3,(H,24,25) |
InChiKey: | InChIKey=VICJJIPEMSYWEU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.