* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-90647 |
English Synonyms: | CHEMMAKER BCB-90647 |
MDL Number.: | MFCD18772725 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccnc(c2C)N3CCN(CC3)CCC(=O)O |
InChi: | InChI=1S/C19H30BN3O4/c1-14-15(20-26-18(2,3)19(4,5)27-20)6-8-21-17(14)23-12-10-22(11-13-23)9-7-16(24)25/h6,8H,7,9-13H2,1-5H3,(H,24,25) |
InChiKey: | InChIKey=PYJAETWCSGJNEZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.