* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-90648 |
| English Synonyms: | CHEMMAKER BCB-90648 |
| MDL Number.: | MFCD18772726 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(nc(c2)N3CCN(CC3)CCC(=O)O)C |
| InChi: | InChI=1S/C19H30BN3O4/c1-14-12-15(20-26-18(2,3)19(4,5)27-20)13-16(21-14)23-10-8-22(9-11-23)7-6-17(24)25/h12-13H,6-11H2,1-5H3,(H,24,25) |
| InChiKey: | InChIKey=NSHQAFLYGWTAOT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.