* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-90828 |
| English Synonyms: | CHEMMAKER BCB-90828 |
| MDL Number.: | MFCD18772900 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(nc(c2)N3CCN(CC3)c4ncccn4)C |
| InChi: | InChI=1S/C20H28BN5O2/c1-15-13-16(21-27-19(2,3)20(4,5)28-21)14-17(24-15)25-9-11-26(12-10-25)18-22-7-6-8-23-18/h6-8,13-14H,9-12H2,1-5H3 |
| InChiKey: | InChIKey=MHMCOYDHKRXBGL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.