* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-91053 |
| English Synonyms: | CHEMMAKER BCB-91053 |
| MDL Number.: | MFCD18773122 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(nc(c2)N3CCCC3c4cccc(c4)F)C |
| InChi: | InChI=1S/C22H28BFN2O2/c1-15-12-17(23-27-21(2,3)22(4,5)28-23)14-20(25-15)26-11-7-10-19(26)16-8-6-9-18(24)13-16/h6,8-9,12-14,19H,7,10-11H2,1-5H3 |
| InChiKey: | InChIKey=XANTVZOBGTWPCV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.