* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-91336 |
English Synonyms: | CHEMMAKER BCB-91336 |
MDL Number.: | MFCD18773400 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(nc2N3CCC(CC3)CC(=O)OCC)Cl |
InChi: | InChI=1S/C20H30BClN2O4/c1-6-26-17(25)13-14-9-11-24(12-10-14)18-15(7-8-16(22)23-18)21-27-19(2,3)20(4,5)28-21/h7-8,14H,6,9-13H2,1-5H3 |
InChiKey: | InChIKey=AHKFZHGQEIEWQK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.