* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-91340 |
English Synonyms: | CHEMMAKER BCB-91340 |
MDL Number.: | MFCD18773404 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2cnc(cc2C)N3CCC(CC3)CC(=O)OCC |
InChi: | InChI=1S/C21H33BN2O4/c1-7-26-19(25)13-16-8-10-24(11-9-16)18-12-15(2)17(14-23-18)22-27-20(3,4)21(5,6)28-22/h12,14,16H,7-11,13H2,1-6H3 |
InChiKey: | InChIKey=XQYORQKTWQAVQB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.