* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-91346 |
English Synonyms: | CHEMMAKER BCB-91346 |
MDL Number.: | MFCD18773410 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(cnc2N(C3CNC3)C(=O)OC(C)(C)C)C |
InChi: | InChI=1S/C20H32BN3O4/c1-13-9-15(21-27-19(5,6)20(7,8)28-21)16(23-10-13)24(14-11-22-12-14)17(25)26-18(2,3)4/h9-10,14,22H,11-12H2,1-8H3 |
InChiKey: | InChIKey=RFLVQRYWSWGGAH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.