* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-91558 |
| English Synonyms: | CHEMMAKER BCB-91558 |
| MDL Number.: | MFCD18773571 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(nc2C#N)N3CCC(CC3)C(C)(C)C |
| InChi: | InChI=1S/C21H32BN3O2/c1-19(2,3)15-10-12-25(13-11-15)18-9-8-16(17(14-23)24-18)22-26-20(4,5)21(6,7)27-22/h8-9,15H,10-13H2,1-7H3 |
| InChiKey: | InChIKey=QXQZZGAYVAGJRM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.