* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-91632 |
| English Synonyms: | CHEMMAKER BCB-91632 |
| MDL Number.: | MFCD18773640 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccnc(c2F)N3CCN(CC3)S(=O)(=O)CC |
| InChi: | InChI=1S/C17H27BFN3O4S/c1-6-27(23,24)22-11-9-21(10-12-22)15-14(19)13(7-8-20-15)18-25-16(2,3)17(4,5)26-18/h7-8H,6,9-12H2,1-5H3 |
| InChiKey: | InChIKey=HANXXRGNVVIRTN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.