* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-92156 |
| English Synonyms: | CHEMMAKER BCB-92156 |
| MDL Number.: | MFCD18774083 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(cnc2N3CCN(CC3)CCC(=O)OCC)C |
| InChi: | InChI=1S/C21H34BN3O4/c1-7-27-18(26)8-9-24-10-12-25(13-11-24)19-17(14-16(2)15-23-19)22-28-20(3,4)21(5,6)29-22/h14-15H,7-13H2,1-6H3 |
| InChiKey: | InChIKey=NDXIRPKEQKBLAU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.