* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-93588 |
English Synonyms: | CHEMMAKER BCB-93588 |
MDL Number.: | MFCD18775417 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(nc2C)N3CCC(C3)N(C)C(=O)OC(C)(C)C |
InChi: | InChI=1S/C22H36BN3O4/c1-15-17(23-29-21(5,6)22(7,8)30-23)10-11-18(24-15)26-13-12-16(14-26)25(9)19(27)28-20(2,3)4/h10-11,16H,12-14H2,1-9H3 |
InChiKey: | InChIKey=GUZLUKGZFOXKQT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.