* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-93958 |
| English Synonyms: | CHEMMAKER BCB-93958 |
| MDL Number.: | MFCD18775607 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(nc2N(CC3CCNCC3)C(=O)OC(C)(C)C)C#N |
| InChi: | InChI=1S/C23H35BN4O4/c1-21(2,3)30-20(29)28(15-16-10-12-26-13-11-16)19-18(9-8-17(14-25)27-19)24-31-22(4,5)23(6,7)32-24/h8-9,16,26H,10-13,15H2,1-7H3 |
| InChiKey: | InChIKey=GFENCMQDBBSAKY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.