* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-93965 |
| English Synonyms: | CHEMMAKER BCB-93965 |
| MDL Number.: | MFCD18775614 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(cc(n2)N(CC3CCNCC3)C(=O)OC(C)(C)C)Cl |
| InChi: | InChI=1S/C22H35BClN3O4/c1-20(2,3)29-19(28)27(14-15-8-10-25-11-9-15)18-13-16(24)12-17(26-18)23-30-21(4,5)22(6,7)31-23/h12-13,15,25H,8-11,14H2,1-7H3 |
| InChiKey: | InChIKey=RSSOVPUUXFDJRR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.