* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-95541 |
| English Synonyms: | CHEMMAKER BCB-95541 |
| MDL Number.: | MFCD18775846 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cccc(n2)CNCCC(C)C |
| InChi: | InChI=1S/C17H29BN2O2/c1-13(2)10-11-19-12-14-8-7-9-15(20-14)18-21-16(3,4)17(5,6)22-18/h7-9,13,19H,10-12H2,1-6H3 |
| InChiKey: | InChIKey=YPIJQNALAVJUCH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.