* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-99249 |
| English Synonyms: | CHEMMAKER BCB-99249 |
| MDL Number.: | MFCD18779113 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cccc(c2)CN3CCC(CC3)NC(=O)OC(C)(C)C |
| InChi: | InChI=1S/C23H37BN2O4/c1-21(2,3)28-20(27)25-19-11-13-26(14-12-19)16-17-9-8-10-18(15-17)24-29-22(4,5)23(6,7)30-24/h8-10,15,19H,11-14,16H2,1-7H3,(H,25,27) |
| InChiKey: | InChIKey=CKWPCELCDVJPKF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.