* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER CMAM-01211 |
| English Synonyms: | CHEMMAKER CMAM-01211 |
| MDL Number.: | MFCD18779373 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CNC(c1c(cc(cc1OC)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChi: | InChI=1S/C12H10F9NO/c1-22-9(12(19,20)21)8-6(11(16,17)18)3-5(10(13,14)15)4-7(8)23-2/h3-4,9,22H,1-2H3 |
| InChiKey: | InChIKey=GPDKOXHBTVZXDO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.