* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-81684 |
| English Synonyms: | CHEMMAKER BCB-81684 |
| MDL Number.: | MFCD18780726 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(c(n2)NCC(C)(C)C)C#N |
| InChi: | InChI=1S/C17H26BN3O2/c1-15(2,3)11-20-14-12(10-19)8-9-13(21-14)18-22-16(4,5)17(6,7)23-18/h8-9H,11H2,1-7H3,(H,20,21) |
| InChiKey: | InChIKey=SOBCSELCJBGMQS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.