* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-110047 |
| English Synonyms: | CHEMMAKER BCB-110047 |
| MDL Number.: | MFCD18781211 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | [B-](CN[C@H](C)C1CC1)(F)(F)F.[K+] |
| InChi: | InChI=1S/C6H12BF3N.K/c1-5(6-2-3-6)11-4-7(8,9)10;/h5-6,11H,2-4H2,1H3;/q-1;+1/t5-;/m1./s1 |
| InChiKey: | InChIKey=IZYLDZOKKDQZLP-NUBCRITNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.