* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER CMSA-00775 |
| English Synonyms: | CHEMMAKER CMSA-00775 |
| MDL Number.: | MFCD18781490 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC(C)c1ccc(cc1)/C=N/[S@@](=O)C(C)(C)C |
| InChi: | InChI=1S/C14H21NOS/c1-11(2)13-8-6-12(7-9-13)10-15-17(16)14(3,4)5/h6-11H,1-5H3/b15-10+/t17-/m0/s1 |
| InChiKey: | InChIKey=ICICZBZKUQJFFD-OBHPCNEJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.