* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER CMSA-00788 |
| English Synonyms: | CHEMMAKER CMSA-00788 |
| MDL Number.: | MFCD18781496 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCOc1ccc(cc1)/C=N/[S@@](=O)C(C)(C)C |
| InChi: | InChI=1S/C13H19NO2S/c1-5-16-12-8-6-11(7-9-12)10-14-17(15)13(2,3)4/h6-10H,5H2,1-4H3/b14-10+/t17-/m0/s1 |
| InChiKey: | InChIKey=SMWMDXWSZCMELS-SHRNQRGKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.