* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER CMSA-00883 |
| English Synonyms: | CHEMMAKER CMSA-00883 |
| MDL Number.: | MFCD18781538 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CC(C)(C)[S@](=O)/N=C/c1ccc(c(c1F)OC)F |
| InChi: | InChI=1S/C12H15F2NO2S/c1-12(2,3)18(16)15-7-8-5-6-9(13)11(17-4)10(8)14/h5-7H,1-4H3/b15-7+/t18-/m0/s1 |
| InChiKey: | InChIKey=PUKRNLAZYLNPJR-APSGNOSNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.