* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER CMSA-00996 |
| English Synonyms: | CHEMMAKER CMSA-00996 |
| MDL Number.: | MFCD18781587 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CC(C)(C)[S@](=O)/N=C/c1cccc(c1OCC#N)OC |
| InChi: | InChI=1S/C14H18N2O3S/c1-14(2,3)20(17)16-10-11-6-5-7-12(18-4)13(11)19-9-8-15/h5-7,10H,9H2,1-4H3/b16-10+/t20-/m0/s1 |
| InChiKey: | InChIKey=ZUHLLTFSTYRGSS-QGRTWZNFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.