* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER CMSA-01003 |
| English Synonyms: | CHEMMAKER CMSA-01003 |
| MDL Number.: | MFCD18781590 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC(C)(C)[S@](=O)/N=C/c1cc(ccc1F)C(F)(F)F |
| InChi: | InChI=1S/C12H13F4NOS/c1-11(2,3)19(18)17-7-8-6-9(12(14,15)16)4-5-10(8)13/h4-7H,1-3H3/b17-7+/t19-/m0/s1 |
| InChiKey: | InChIKey=FECUGXKORFMIMR-CQXYXCHQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.