* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-110640 |
| English Synonyms: | CHEMMAKER BCB-110640 |
| MDL Number.: | MFCD18781598 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | [B-](CN([C@@H]1CCCNC1)C(=O)OC(C)(C)C)(F)(F)F.[K+] |
| InChi: | InChI=1S/C11H21BF3N2O2.K/c1-11(2,3)19-10(18)17(8-12(13,14)15)9-5-4-6-16-7-9;/h9,16H,4-8H2,1-3H3;/q-1;+1/t9-;/m1./s1 |
| InChiKey: | InChIKey=JJAXZBPNOQTBKE-SBSPUUFOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.