* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER CMSA-00592 |
| English Synonyms: | CHEMMAKER CMSA-00592 |
| MDL Number.: | MFCD18781684 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC(C)(C)[S@@](=O)/N=C/c1cc(c(s1)Br)Br |
| InChi: | InChI=1S/C9H11Br2NOS2/c1-9(2,3)15(13)12-5-6-4-7(10)8(11)14-6/h4-5H,1-3H3/b12-5+/t15-/m1/s1 |
| InChiKey: | InChIKey=LKXYWIAZURISHA-FDYAIDJWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.