* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER CMSA-01221 |
| English Synonyms: | CHEMMAKER CMSA-01221 |
| MDL Number.: | MFCD18781780 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CC(C)(C)[S@](=O)/N=C/c1cn(c2c1cccc2)S(=O)(=O)c3ccccc3 |
| InChi: | InChI=1S/C19H20N2O3S2/c1-19(2,3)25(22)20-13-15-14-21(18-12-8-7-11-17(15)18)26(23,24)16-9-5-4-6-10-16/h4-14H,1-3H3/b20-13+/t25-/m0/s1 |
| InChiKey: | InChIKey=LWLZIMNLYDMRDI-VGNXUAKHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.