* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GIBBERELLIN A5 |
| CAS: | 561-56-8 |
| English Synonyms: | GIBBERELLIN A5 |
| MDL Number.: | MFCD18781896 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | C[C@@]12C=CC[C@@]3([C@@H]1[C@@H]([C@]45[C@H]3CC[C@](C4)(C(=C)C5)O)C(=O)O)OC2=O |
| InChi: | InChI=1S/C19H22O5/c1-10-8-17-9-18(10,23)7-4-11(17)19-6-3-5-16(2,15(22)24-19)13(19)12(17)14(20)21/h3,5,11-13,23H,1,4,6-9H2,2H3,(H,20,21)/t11-,12-,13-,16-,17+,18+,19-/m1/s1 |
| InChiKey: | InChIKey=ZOWHLBOPCIHIHW-KQBHUUJHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.