* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GIBBERELLIN A12 |
| CAS: | 1164-45-0 |
| English Synonyms: | GIBBERELLIN A12 |
| MDL Number.: | MFCD18781899 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | C[C@@]12CCC[C@@]([C@H]1[C@@H]([C@]34[C@H]2CC[C@H](C3)C(=C)C4)C(=O)O)(C)C(=O)O |
| InChi: | InChI=1S/C20H28O4/c1-11-9-20-10-12(11)5-6-13(20)18(2)7-4-8-19(3,17(23)24)15(18)14(20)16(21)22/h12-15H,1,4-10H2,2-3H3,(H,21,22)(H,23,24)/t12-,13+,14-,15+,18+,19-,20+/m1/s1 |
| InChiKey: | InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.