* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GIBBERELLIN A24 |
| CAS: | 19427-32-8 |
| English Synonyms: | GIBBERELLIN A24 |
| MDL Number.: | MFCD18781904 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | C[C@]1(CCC[C@@]2([C@@H]1[C@@H]([C@]34[C@H]2CC[C@H](C3)C(=C)C4)C(=O)O)C=O)C(=O)O |
| InChi: | InChI=1S/C20H26O5/c1-11-8-20-9-12(11)4-5-13(20)19(10-21)7-3-6-18(2,17(24)25)15(19)14(20)16(22)23/h10,12-15H,1,3-9H2,2H3,(H,22,23)(H,24,25)/t12-,13+,14-,15-,18-,19-,20+/m1/s1 |
| InChiKey: | InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.