* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GIBBERELLIN A29 |
| CAS: | 29774-53-6 |
| English Synonyms: | GIBBERELLIN A29 |
| MDL Number.: | MFCD18781905 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | C[C@@]12C[C@H](C[C@@]3([C@@H]1[C@@H]([C@]45[C@H]3CC[C@](C4)(C(=C)C5)O)C(=O)O)OC2=O)O |
| InChi: | InChI=1S/C19H24O6/c1-9-5-17-8-18(9,24)4-3-11(17)19-7-10(20)6-16(2,15(23)25-19)13(19)12(17)14(21)22/h10-13,20,24H,1,3-8H2,2H3,(H,21,22)/t10-,11-,12-,13-,16-,17+,18+,19-/m1/s1 |
| InChiKey: | InChIKey=BKBYHSYZKIAJDA-WWSAFQOPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.