* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GIBBERELLIN A44 |
| CAS: | 36434-15-8 |
| English Synonyms: | GIBBERELLIN A44 |
| MDL Number.: | MFCD18781907 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | C[C@@]12CCC[C@@]3([C@@H]1[C@@H]([C@]45[C@H]3CC[C@](C4)(C(=C)C5)O)C(=O)O)COC2=O |
| InChi: | InChI=1S/C20H26O5/c1-11-8-19-9-20(11,24)7-4-12(19)18-6-3-5-17(2,16(23)25-10-18)14(18)13(19)15(21)22/h12-14,24H,1,3-10H2,2H3,(H,21,22)/t12-,13+,14+,17+,18+,19-,20-/m0/s1 |
| InChiKey: | InChIKey=KSBJAONOPKRVRR-YTJHIPEWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.