* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GI 181771 |
CAS: | 305366-98-7 |
English Synonyms: | GI 181771 |
MDL Number.: | MFCD18782592 |
H bond acceptor: | 11 |
H bond donor: | 3 |
Smile: | CC(C)N(c1ccccc1)C(=O)CN2c3ccccc3N(C(=O)[C@H](C2=O)NC(=O)Nc4cccc(c4)C(=O)O)c5ccccc5 |
InChi: | InChI=1S/C34H31N5O6/c1-22(2)38(25-14-5-3-6-15-25)29(40)21-37-27-18-9-10-19-28(27)39(26-16-7-4-8-17-26)32(42)30(31(37)41)36-34(45)35-24-13-11-12-23(20-24)33(43)44/h3-20,22,30H,21H2,1-2H3,(H,43,44)(H2,35,36,45)/t30-/m0/s1 |
InChiKey: | InChIKey=CABBMMXFOOZVMS-PMERELPUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.