* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JNJ 2408068 |
CAS: | 317846-22-3 |
English Synonyms: | JNJ 2408068 |
MDL Number.: | MFCD18782600 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | Cc1cccc2c1nc(n2Cc3c(ccc(n3)C)O)NC4CCN(CC4)CCN |
InChi: | InChI=1S/C22H30N6O/c1-15-4-3-5-19-21(15)26-22(25-17-8-11-27(12-9-17)13-10-23)28(19)14-18-20(29)7-6-16(2)24-18/h3-7,17,29H,8-14,23H2,1-2H3,(H,25,26) |
InChiKey: | InChIKey=RDQSNNMSDOHAPG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.