* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VESTIPITANT |
| CAS: | 334476-46-9 |
| English Synonyms: | VESTIPITANT |
| MDL Number.: | MFCD18782628 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | C[C@H](c1cc(cc(c1)C(F)(F)F)C(F)(F)F)N(C)C(=O)N2CCNC[C@@H]2c3ccc(cc3C(F)(F)F)F |
| InChi: | InChI=1S/C23H21F10N3O/c1-12(13-7-14(21(25,26)27)9-15(8-13)22(28,29)30)35(2)20(37)36-6-5-34-11-19(36)17-4-3-16(24)10-18(17)23(31,32)33/h3-4,7-10,12,19,34H,5-6,11H2,1-2H3/t12-,19-/m1/s1 |
| InChiKey: | InChIKey=FRBNMOFIMDUNIJ-CWTRNNRKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.