* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GW 642444X |
CAS: | 503068-34-6 |
English Synonyms: | VILANTEROL ; GW 642444X |
MDL Number.: | MFCD18782703 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | c1cc(c(c(c1)Cl)COCCOCCCCCCNC[C@@H](c2ccc(c(c2)CO)O)O)Cl |
InChi: | InChI=1S/C24H33Cl2NO5/c25-21-6-5-7-22(26)20(21)17-32-13-12-31-11-4-2-1-3-10-27-15-24(30)18-8-9-23(29)19(14-18)16-28/h5-9,14,24,27-30H,1-4,10-13,15-17H2/t24-/m0/s1 |
InChiKey: | InChIKey=DAFYYTQWSAWIGS-DEOSSOPVSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.