Molecular Structure:
CCD No.:CCD04458857
JNJ 31020028
CAS No.:
1094873-14-9
Formula:C34 H36 F N5 O2
MolWeight:565.689
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | JNJ 31020028 |
| CAS： | 1094873-14-9 |
| English Synonyms： | JNJ 31020028 |
| MDL Number.： | MFCD18782744 |
| H bond acceptor： | 7 |
| H bond donor： | 1 |
| Smile： | CCN(CC)C(=O)C(c1ccccc1)N2CCN(CC2)c3ccc(cc3F)NC(=O)c4ccccc4c5cccnc5 |
| InChi： | InChI=1S/C34H36FN5O2/c1-3-38(4-2)34(42)32(25-11-6-5-7-12-25)40-21-19-39(20-22-40)31-17-16-27(23-30(31)35)37-33(41)29-15-9-8-14-28(29)26-13-10-18-36-24-26/h5-18,23-24,32H,3-4,19-22H2,1-2H3,(H,37,41) |
| InChiKey： | InChIKey=OVUNRYUVDVWTTE-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
