* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX110417 |
English Synonyms: | WUXIAPPTEC WX110417 |
MDL Number.: | MFCD18791850 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1C[C@@H]([C@@H]2[C@H]1CCN2C(=O)OCc3ccccc3)O |
InChi: | InChI=1S/C19H26N2O5/c1-19(2,3)26-18(24)21-11-15(22)16-14(21)9-10-20(16)17(23)25-12-13-7-5-4-6-8-13/h4-8,14-16,22H,9-12H2,1-3H3/t14-,15+,16+/m1/s1 |
InChiKey: | InChIKey=KKKAZQNBWKRKSB-PMPSAXMXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.