* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX110478 |
English Synonyms: | WUXIAPPTEC WX110478 |
MDL Number.: | MFCD18791907 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1CC[C@H]2[C@@H](CC1)S(=O)(=O)CCN2 |
InChi: | InChI=1S/C13H24N2O4S/c1-13(2,3)19-12(16)15-7-4-10-11(5-8-15)20(17,18)9-6-14-10/h10-11,14H,4-9H2,1-3H3/t10-,11+/m0/s1 |
InChiKey: | InChIKey=MHOOPRKAHUGKAY-WDEREUQCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.