* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX115390 |
English Synonyms: | WUXIAPPTEC WX115390 |
MDL Number.: | MFCD18791974 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | CC(C)(C)OC(=O)N1C[C@@H]2c3c(cnc(n3)SC)CS(=O)(=O)[C@@H]2C1 |
InChi: | InChI=1S/C15H21N3O4S2/c1-15(2,3)22-14(19)18-6-10-11(7-18)24(20,21)8-9-5-16-13(23-4)17-12(9)10/h5,10-11H,6-8H2,1-4H3/t10-,11+/m0/s1 |
InChiKey: | InChIKey=ZWAWFNGUCYWLQC-WDEREUQCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.